C26H28N4O4S — CID 6412795
[3-(7-acetyl-3-hexylsulfanyl-6H-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl)phenyl] acetate (PubChem CID 6412795) has the molecular formula C26H28N4O4S and a molecular weight of 492.60 g/mol. Its IUPAC name is [3-(7-acetyl-3-hexylsulfanyl-6H-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl)phenyl] acetate.
| Compound Name | [3-(7-acetyl-3-hexylsulfanyl-6H-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl)phenyl] acetate |
|---|---|
| PubChem CID | 6412795 |
| Molecular Formula | C26H28N4O4S |
| Molecular Weight | 492.60 g/mol |
| Exact Mass | 492.18 |
| IUPAC Name | [3-(7-acetyl-3-hexylsulfanyl-6H-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl)phenyl] acetate |
| SMILES | CCCCCCSc1nnc2c(n1)OC(c1cccc(OC(C)=O)c1)N(C(C)=O)c1ccccc1-2 |
| InChI | InChI=1S/C26H28N4O4S/c1-4-5-6-9-15-35-26-27-24-23(28-29-26)21-13-7-8-14-22(21)30(17(2)31)25(34-24)19-11-10-12-20(16-19)33-18(3)32/h7-8,10-14,16,25H,4-6,9,15H2,1-3H3 |
| InChIKey | QWDVURMBWTYLKL-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 94.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.60 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|