C22H24N2O3S — CID 39766635
N-(2,4-dimethoxyphenyl)-3-(4,8-dimethylquinolin-2-yl)sulfanylpropanamide (PubChem CID 39766635) has the molecular formula C22H24N2O3S and a molecular weight of 396.51 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-3-(4,8-dimethylquinolin-2-yl)sulfanylpropanamide.
| Compound Name | N-(2,4-dimethoxyphenyl)-3-(4,8-dimethylquinolin-2-yl)sulfanylpropanamide |
|---|---|
| PubChem CID | 39766635 |
| Molecular Formula | C22H24N2O3S |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-3-(4,8-dimethylquinolin-2-yl)sulfanylpropanamide |
| SMILES | COc1ccc(NC(=O)CCSc2cc(C)c3cccc(C)c3n2)c(OC)c1 |
| InChI | InChI=1S/C22H24N2O3S/c1-14-6-5-7-17-15(2)12-21(24-22(14)17)28-11-10-20(25)23-18-9-8-16(26-3)13-19(18)27-4/h5-9,12-13H,10-11H2,1-4H3,(H,23,25) |
| InChIKey | AWQIVSFWXUJBJV-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |