C21H22N2O2S — CID 46302888
3-(8-methoxy-4-methylquinolin-2-yl)sulfanyl-N-(4-methylphenyl)propanamide (PubChem CID 46302888) has the molecular formula C21H22N2O2S and a molecular weight of 366.49 g/mol. Its IUPAC name is 3-(8-methoxy-4-methylquinolin-2-yl)sulfanyl-N-(4-methylphenyl)propanamide.
| Compound Name | 3-(8-methoxy-4-methylquinolin-2-yl)sulfanyl-N-(4-methylphenyl)propanamide |
|---|---|
| PubChem CID | 46302888 |
| Molecular Formula | C21H22N2O2S |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | 3-(8-methoxy-4-methylquinolin-2-yl)sulfanyl-N-(4-methylphenyl)propanamide |
| SMILES | COc1cccc2c(C)cc(SCCC(=O)Nc3ccc(C)cc3)nc12 |
| InChI | InChI=1S/C21H22N2O2S/c1-14-7-9-16(10-8-14)22-19(24)11-12-26-20-13-15(2)17-5-4-6-18(25-3)21(17)23-20/h4-10,13H,11-12H2,1-3H3,(H,22,24) |
| InChIKey | GHJJVSPQCBNIGQ-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |