C11H11ClN4OS — CID 107779699
N-(2-amino-5-chlorophenyl)-2-(1H-imidazol-2-ylsulfanyl)acetamide (PubChem CID 107779699) has the molecular formula C11H11ClN4OS and a molecular weight of 282.76 g/mol. Its IUPAC name is N-(2-amino-5-chlorophenyl)-2-(1H-imidazol-2-ylsulfanyl)acetamide.
| Compound Name | N-(2-amino-5-chlorophenyl)-2-(1H-imidazol-2-ylsulfanyl)acetamide |
|---|---|
| PubChem CID | 107779699 |
| Molecular Formula | C11H11ClN4OS |
| Molecular Weight | 282.76 g/mol |
| Exact Mass | 282.03 |
| IUPAC Name | N-(2-amino-5-chlorophenyl)-2-(1H-imidazol-2-ylsulfanyl)acetamide |
| SMILES | Nc1ccc(Cl)cc1NC(=O)CSc1ncc[nH]1 |
| InChI | InChI=1S/C11H11ClN4OS/c12-7-1-2-8(13)9(5-7)16-10(17)6-18-11-14-3-4-15-11/h1-5H,6,13H2,(H,14,15)(H,16,17) |
| InChIKey | BWKYRYUPHVWBJK-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.76 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|