C18H21N3O2 — CID 155547009
N-[5-(2-aminoanilino)-5-oxopentyl]benzamide (PubChem CID 155547009) has the molecular formula C18H21N3O2 and a molecular weight of 311.39 g/mol. Its IUPAC name is N-[5-(2-aminoanilino)-5-oxopentyl]benzamide.
| Compound Name | N-[5-(2-aminoanilino)-5-oxopentyl]benzamide |
|---|---|
| PubChem CID | 155547009 |
| Molecular Formula | C18H21N3O2 |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | N-[5-(2-aminoanilino)-5-oxopentyl]benzamide |
| SMILES | Nc1ccccc1NC(=O)CCCCNC(=O)c1ccccc1 |
| InChI | InChI=1S/C18H21N3O2/c19-15-10-4-5-11-16(15)21-17(22)12-6-7-13-20-18(23)14-8-2-1-3-9-14/h1-5,8-11H,6-7,12-13,19H2,(H,20,23)(H,21,22) |
| InChIKey | PSDULCGBSAPYKD-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|