C17H22N4O2 — CID 45137576
N-[6-(2-aminoanilino)-6-oxohexyl]-1H-pyrrole-2-carboxamide (PubChem CID 45137576) has the molecular formula C17H22N4O2 and a molecular weight of 314.39 g/mol. Its IUPAC name is N-[6-(2-aminoanilino)-6-oxohexyl]-1H-pyrrole-2-carboxamide.
| Compound Name | N-[6-(2-aminoanilino)-6-oxohexyl]-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 45137576 |
| Molecular Formula | C17H22N4O2 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | N-[6-(2-aminoanilino)-6-oxohexyl]-1H-pyrrole-2-carboxamide |
| SMILES | Nc1ccccc1NC(=O)CCCCCNC(=O)c1ccc[nH]1 |
| InChI | InChI=1S/C17H22N4O2/c18-13-7-3-4-8-14(13)21-16(22)10-2-1-5-11-20-17(23)15-9-6-12-19-15/h3-4,6-9,12,19H,1-2,5,10-11,18H2,(H,20,23)(H,21,22) |
| InChIKey | ZECLVEPTQPQIHX-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 100.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|