C23H28N6O2 — CID 162514443
N-[6-(2-aminoanilino)-6-oxohexyl]-3-[4-(methylamino)phenyl]-1H-pyrazole-5-carboxamide (PubChem CID 162514443) has the molecular formula C23H28N6O2 and a molecular weight of 420.52 g/mol. Its IUPAC name is N-[6-(2-aminoanilino)-6-oxohexyl]-3-[4-(methylamino)phenyl]-1H-pyrazole-5-carboxamide.
| Compound Name | N-[6-(2-aminoanilino)-6-oxohexyl]-3-[4-(methylamino)phenyl]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 162514443 |
| Molecular Formula | C23H28N6O2 |
| Molecular Weight | 420.52 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | N-[6-(2-aminoanilino)-6-oxohexyl]-3-[4-(methylamino)phenyl]-1H-pyrazole-5-carboxamide |
| SMILES | CNc1ccc(-c2cc(C(=O)NCCCCCC(=O)Nc3ccccc3N)[nH]n2)cc1 |
| InChI | InChI=1S/C23H28N6O2/c1-25-17-12-10-16(11-13-17)20-15-21(29-28-20)23(31)26-14-6-2-3-9-22(30)27-19-8-5-4-7-18(19)24/h4-5,7-8,10-13,15,25H,2-3,6,9,14,24H2,1H3,(H,26,31)(H,27,30)(H,28,29) |
| InChIKey | DMGVZPFHKHCARN-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 124.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.52 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|