C28H30ClN5O3 — CID 68846681
N-[6-(2-aminoanilino)-6-oxohexyl]-5-[(Z)-(5-chloro-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethyl-1H-pyrrole-3-carboxamide (PubChem CID 68846681) has the molecular formula C28H30ClN5O3 and a molecular weight of 520.03 g/mol. Its IUPAC name is N-[6-(2-aminoanilino)-6-oxohexyl]-5-[(Z)-(5-chloro-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethyl-1H-pyrrole-3-carboxamide.
| Compound Name | N-[6-(2-aminoanilino)-6-oxohexyl]-5-[(Z)-(5-chloro-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethyl-1H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 68846681 |
| Molecular Formula | C28H30ClN5O3 |
| Molecular Weight | 520.03 g/mol |
| Exact Mass | 519.20 |
| IUPAC Name | N-[6-(2-aminoanilino)-6-oxohexyl]-5-[(Z)-(5-chloro-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethyl-1H-pyrrole-3-carboxamide |
| SMILES | Cc1[nH]c(/C=C2\C(=O)Nc3ccc(Cl)cc32)c(C)c1C(=O)NCCCCCC(=O)Nc1ccccc1N |
| InChI | InChI=1S/C28H30ClN5O3/c1-16-24(15-20-19-14-18(29)11-12-22(19)34-27(20)36)32-17(2)26(16)28(37)31-13-7-3-4-10-25(35)33-23-9-6-5-8-21(23)30/h5-6,8-9,11-12,14-15,32H,3-4,7,10,13,30H2,1-2H3,(H,31,37)(H,33,35)(H,34,36)/b20-15- |
| InChIKey | KTRPYLYJVXRXFJ-HKWRFOASSA-N |
| XLogP | 5.29 |
| TPSA | 129.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.03 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|