C32H32FN7O3 — CID 44511330
N-(2-aminophenyl)-6-[4-[[5-[(Z)-(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethyl-1H-pyrrole-3-carbonyl]amino]butylamino]pyridine-3-carboxamide (PubChem CID 44511330) has the molecular formula C32H32FN7O3 and a molecular weight of 581.65 g/mol. Its IUPAC name is N-(2-aminophenyl)-6-[4-[[5-[(Z)-(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethyl-1H-pyrrole-3-carbonyl]amino]butylamino]pyridine-3-carboxamide.
| Compound Name | N-(2-aminophenyl)-6-[4-[[5-[(Z)-(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethyl-1H-pyrrole-3-carbonyl]amino]butylamino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 44511330 |
| Molecular Formula | C32H32FN7O3 |
| Molecular Weight | 581.65 g/mol |
| Exact Mass | 581.26 |
| IUPAC Name | N-(2-aminophenyl)-6-[4-[[5-[(Z)-(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethyl-1H-pyrrole-3-carbonyl]amino]butylamino]pyridine-3-carboxamide |
| SMILES | Cc1[nH]c(/C=C2\C(=O)Nc3ccc(F)cc32)c(C)c1C(=O)NCCCCNc1ccc(C(=O)Nc2ccccc2N)cn1 |
| InChI | InChI=1S/C32H32FN7O3/c1-18-27(16-23-22-15-21(33)10-11-25(22)39-31(23)42)38-19(2)29(18)32(43)36-14-6-5-13-35-28-12-9-20(17-37-28)30(41)40-26-8-4-3-7-24(26)34/h3-4,7-12,15-17,38H,5-6,13-14,34H2,1-2H3,(H,35,37)(H,36,43)(H,39,42)(H,40,41)/b23-16- |
| InChIKey | IOPHBQIUJGTDKA-KQWNVCNZSA-N |
| XLogP | 5.11 |
| TPSA | 154.03 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.65 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|