C29H32FN5O4 — CID 68848126
N-[6-(2-amino-4-methoxyanilino)-6-oxohexyl]-5-[(Z)-(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethyl-1H-pyrrole-3-carboxamide (PubChem CID 68848126) has the molecular formula C29H32FN5O4 and a molecular weight of 533.60 g/mol. Its IUPAC name is N-[6-(2-amino-4-methoxyanilino)-6-oxohexyl]-5-[(Z)-(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethyl-1H-pyrrole-3-carboxamide.
| Compound Name | N-[6-(2-amino-4-methoxyanilino)-6-oxohexyl]-5-[(Z)-(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethyl-1H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 68848126 |
| Molecular Formula | C29H32FN5O4 |
| Molecular Weight | 533.60 g/mol |
| Exact Mass | 533.24 |
| IUPAC Name | N-[6-(2-amino-4-methoxyanilino)-6-oxohexyl]-5-[(Z)-(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethyl-1H-pyrrole-3-carboxamide |
| SMILES | COc1ccc(NC(=O)CCCCCNC(=O)c2c(C)[nH]c(/C=C3\C(=O)Nc4ccc(F)cc43)c2C)c(N)c1 |
| InChI | InChI=1S/C29H32FN5O4/c1-16-25(15-21-20-13-18(30)8-10-23(20)35-28(21)37)33-17(2)27(16)29(38)32-12-6-4-5-7-26(36)34-24-11-9-19(39-3)14-22(24)31/h8-11,13-15,33H,4-7,12,31H2,1-3H3,(H,32,38)(H,34,36)(H,35,37)/b21-15- |
| InChIKey | WSSLAXCZSJBGQU-QNGOZBTKSA-N |
| XLogP | 4.78 |
| TPSA | 138.34 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.60 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|