C31H30FN7O3 — CID 67279776
N-(2-amino-4-methylphenyl)-6-[2-[[5-[(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethyl-1H-pyrrole-3-carbonyl]amino]ethylamino]pyridine-3-carboxamide (PubChem CID 67279776) has the molecular formula C31H30FN7O3 and a molecular weight of 567.63 g/mol. Its IUPAC name is N-(2-amino-4-methylphenyl)-6-[2-[[5-[(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethyl-1H-pyrrole-3-carbonyl]amino]ethylamino]pyridine-3-carboxamide.
| Compound Name | N-(2-amino-4-methylphenyl)-6-[2-[[5-[(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethyl-1H-pyrrole-3-carbonyl]amino]ethylamino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 67279776 |
| Molecular Formula | C31H30FN7O3 |
| Molecular Weight | 567.63 g/mol |
| Exact Mass | 567.24 |
| IUPAC Name | N-(2-amino-4-methylphenyl)-6-[2-[[5-[(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethyl-1H-pyrrole-3-carbonyl]amino]ethylamino]pyridine-3-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2ccc(NCCNC(=O)c3c(C)[nH]c(C=C4C(=O)Nc5ccc(F)cc54)c3C)nc2)c(N)c1 |
| InChI | InChI=1S/C31H30FN7O3/c1-16-4-7-25(23(33)12-16)39-29(40)19-5-9-27(36-15-19)34-10-11-35-31(42)28-17(2)26(37-18(28)3)14-22-21-13-20(32)6-8-24(21)38-30(22)41/h4-9,12-15,37H,10-11,33H2,1-3H3,(H,34,36)(H,35,42)(H,38,41)(H,39,40) |
| InChIKey | PDPLGOXMBPQHRJ-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 154.03 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.63 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|