C22H18BrFN4O2 — CID 24998596
N-(2-amino-5-bromophenyl)-5-[(Z)-(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethyl-1H-pyrrole-3-carboxamide (PubChem CID 24998596) has the molecular formula C22H18BrFN4O2 and a molecular weight of 469.31 g/mol. Its IUPAC name is N-(2-amino-5-bromophenyl)-5-[(Z)-(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethyl-1H-pyrrole-3-carboxamide.
| Compound Name | N-(2-amino-5-bromophenyl)-5-[(Z)-(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethyl-1H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 24998596 |
| Molecular Formula | C22H18BrFN4O2 |
| Molecular Weight | 469.31 g/mol |
| Exact Mass | 468.06 |
| IUPAC Name | N-(2-amino-5-bromophenyl)-5-[(Z)-(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethyl-1H-pyrrole-3-carboxamide |
| SMILES | Cc1[nH]c(/C=C2\C(=O)Nc3ccc(F)cc32)c(C)c1C(=O)Nc1cc(Br)ccc1N |
| InChI | InChI=1S/C22H18BrFN4O2/c1-10-18(9-15-14-8-13(24)4-6-17(14)27-21(15)29)26-11(2)20(10)22(30)28-19-7-12(23)3-5-16(19)25/h3-9,26H,25H2,1-2H3,(H,27,29)(H,28,30)/b15-9- |
| InChIKey | BEFVFNZGIFMKHC-DHDCSXOGSA-N |
| XLogP | 4.86 |
| TPSA | 100.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.31 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|