C28H29ClFN5O3 — CID 68846126
N-[6-(2-amino-4-chloroanilino)-6-oxohexyl]-5-[(Z)-(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethyl-1H-pyrrole-3-carboxamide (PubChem CID 68846126) has the molecular formula C28H29ClFN5O3 and a molecular weight of 538.02 g/mol. Its IUPAC name is N-[6-(2-amino-4-chloroanilino)-6-oxohexyl]-5-[(Z)-(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethyl-1H-pyrrole-3-carboxamide.
| Compound Name | N-[6-(2-amino-4-chloroanilino)-6-oxohexyl]-5-[(Z)-(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethyl-1H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 68846126 |
| Molecular Formula | C28H29ClFN5O3 |
| Molecular Weight | 538.02 g/mol |
| Exact Mass | 537.19 |
| IUPAC Name | N-[6-(2-amino-4-chloroanilino)-6-oxohexyl]-5-[(Z)-(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethyl-1H-pyrrole-3-carboxamide |
| SMILES | Cc1[nH]c(/C=C2\C(=O)Nc3ccc(F)cc32)c(C)c1C(=O)NCCCCCC(=O)Nc1ccc(Cl)cc1N |
| InChI | InChI=1S/C28H29ClFN5O3/c1-15-24(14-20-19-13-18(30)8-10-22(19)35-27(20)37)33-16(2)26(15)28(38)32-11-5-3-4-6-25(36)34-23-9-7-17(29)12-21(23)31/h7-10,12-14,33H,3-6,11,31H2,1-2H3,(H,32,38)(H,34,36)(H,35,37)/b20-14- |
| InChIKey | AOLWLWDLKZERIJ-ZHZULCJRSA-N |
| XLogP | 5.43 |
| TPSA | 129.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.02 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|