C27H28FN7O3 — CID 135884511
N-[5-(2-aminoanilino)-5-oxopentyl]-5-[(E)-[(Z)-(5-fluoro-2-oxo-1H-indol-3-ylidene)hydrazinylidene]methyl]-2,4-dimethyl-1H-pyrrole-3-carboxamide (PubChem CID 135884511) has the molecular formula C27H28FN7O3 and a molecular weight of 517.57 g/mol. Its IUPAC name is N-[5-(2-aminoanilino)-5-oxopentyl]-5-[(E)-[(Z)-(5-fluoro-2-oxo-1H-indol-3-ylidene)hydrazinylidene]methyl]-2,4-dimethyl-1H-pyrrole-3-carboxamide.
| Compound Name | N-[5-(2-aminoanilino)-5-oxopentyl]-5-[(E)-[(Z)-(5-fluoro-2-oxo-1H-indol-3-ylidene)hydrazinylidene]methyl]-2,4-dimethyl-1H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 135884511 |
| Molecular Formula | C27H28FN7O3 |
| Molecular Weight | 517.57 g/mol |
| Exact Mass | 517.22 |
| IUPAC Name | N-[5-(2-aminoanilino)-5-oxopentyl]-5-[(E)-[(Z)-(5-fluoro-2-oxo-1H-indol-3-ylidene)hydrazinylidene]methyl]-2,4-dimethyl-1H-pyrrole-3-carboxamide |
| SMILES | Cc1[nH]c(/C=N/N=C2\C(=O)Nc3ccc(F)cc32)c(C)c1C(=O)NCCCCC(=O)Nc1ccccc1N |
| InChI | InChI=1S/C27H28FN7O3/c1-15-22(14-31-35-25-18-13-17(28)10-11-20(18)34-27(25)38)32-16(2)24(15)26(37)30-12-6-5-9-23(36)33-21-8-4-3-7-19(21)29/h3-4,7-8,10-11,13-14,32H,5-6,9,12,29H2,1-2H3,(H,30,37)(H,33,36)(H,34,35,38)/b31-14+ |
| InChIKey | KVPBNAYRMMOVJS-XAZZYMPDSA-N |
| XLogP | 3.67 |
| TPSA | 153.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.57 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_isatin(189)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|