C26H32FN5O4 — CID 136624665
methyl 9-[[5-[(E)-[(Z)-(5-fluoro-2-oxo-1H-indol-3-ylidene)hydrazinylidene]methyl]-2,4-dimethyl-1H-pyrrole-3-carbonyl]amino]nonanoate (PubChem CID 136624665) has the molecular formula C26H32FN5O4 and a molecular weight of 497.57 g/mol. Its IUPAC name is methyl 9-[[5-[(E)-[(Z)-(5-fluoro-2-oxo-1H-indol-3-ylidene)hydrazinylidene]methyl]-2,4-dimethyl-1H-pyrrole-3-carbonyl]amino]nonanoate.
| Compound Name | methyl 9-[[5-[(E)-[(Z)-(5-fluoro-2-oxo-1H-indol-3-ylidene)hydrazinylidene]methyl]-2,4-dimethyl-1H-pyrrole-3-carbonyl]amino]nonanoate |
|---|---|
| PubChem CID | 136624665 |
| Molecular Formula | C26H32FN5O4 |
| Molecular Weight | 497.57 g/mol |
| Exact Mass | 497.24 |
| IUPAC Name | methyl 9-[[5-[(E)-[(Z)-(5-fluoro-2-oxo-1H-indol-3-ylidene)hydrazinylidene]methyl]-2,4-dimethyl-1H-pyrrole-3-carbonyl]amino]nonanoate |
| SMILES | COC(=O)CCCCCCCCNC(=O)c1c(C)[nH]c(/C=N/N=C2\C(=O)Nc3ccc(F)cc32)c1C |
| InChI | InChI=1S/C26H32FN5O4/c1-16-21(15-29-32-24-19-14-18(27)11-12-20(19)31-26(24)35)30-17(2)23(16)25(34)28-13-9-7-5-4-6-8-10-22(33)36-3/h11-12,14-15,30H,4-10,13H2,1-3H3,(H,28,34)(H,31,32,35)/b29-15+ |
| InChIKey | QXSADIULPZWVBN-WKULSOCRSA-N |
| XLogP | 4.18 |
| TPSA | 125.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.57 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_isatin(189)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|