C28H30ClN5O3 — CID 154459986
2-amino-N-(2-aminophenyl)-7-[5-[(Z)-(5-chloro-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethyl-1H-pyrrol-3-yl]-7-oxoheptanamide (PubChem CID 154459986) has the molecular formula C28H30ClN5O3 and a molecular weight of 520.03 g/mol. Its IUPAC name is 2-amino-N-(2-aminophenyl)-7-[5-[(Z)-(5-chloro-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethyl-1H-pyrrol-3-yl]-7-oxoheptanamide.
| Compound Name | 2-amino-N-(2-aminophenyl)-7-[5-[(Z)-(5-chloro-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethyl-1H-pyrrol-3-yl]-7-oxoheptanamide |
|---|---|
| PubChem CID | 154459986 |
| Molecular Formula | C28H30ClN5O3 |
| Molecular Weight | 520.03 g/mol |
| Exact Mass | 519.20 |
| IUPAC Name | 2-amino-N-(2-aminophenyl)-7-[5-[(Z)-(5-chloro-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethyl-1H-pyrrol-3-yl]-7-oxoheptanamide |
| SMILES | Cc1[nH]c(/C=C2\C(=O)Nc3ccc(Cl)cc32)c(C)c1C(=O)CCCCC(N)C(=O)Nc1ccccc1N |
| InChI | InChI=1S/C28H30ClN5O3/c1-15-24(14-19-18-13-17(29)11-12-22(18)33-27(19)36)32-16(2)26(15)25(35)10-6-4-8-21(31)28(37)34-23-9-5-3-7-20(23)30/h3,5,7,9,11-14,21,32H,4,6,8,10,30-31H2,1-2H3,(H,33,36)(H,34,37)/b19-14- |
| InChIKey | FOHALUDYPPYQMD-RGEXLXHISA-N |
| XLogP | 5.07 |
| TPSA | 143.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.03 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|