C25H23ClN6O4 — CID 10142102
5-[(Z)-(5-chloro-2-oxo-1H-indol-3-ylidene)methyl]-N-[2-hydroxy-3-(3-oxidobenzotriazol-3-ium-1-yl)propyl]-2,4-dimethyl-1H-pyrrole-3-carboxamide (PubChem CID 10142102) has the molecular formula C25H23ClN6O4 and a molecular weight of 506.95 g/mol. Its IUPAC name is 5-[(Z)-(5-chloro-2-oxo-1H-indol-3-ylidene)methyl]-N-[2-hydroxy-3-(3-oxidobenzotriazol-3-ium-1-yl)propyl]-2,4-dimethyl-1H-pyrrole-3-carboxamide.
| Compound Name | 5-[(Z)-(5-chloro-2-oxo-1H-indol-3-ylidene)methyl]-N-[2-hydroxy-3-(3-oxidobenzotriazol-3-ium-1-yl)propyl]-2,4-dimethyl-1H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 10142102 |
| Molecular Formula | C25H23ClN6O4 |
| Molecular Weight | 506.95 g/mol |
| Exact Mass | 506.15 |
| IUPAC Name | 5-[(Z)-(5-chloro-2-oxo-1H-indol-3-ylidene)methyl]-N-[2-hydroxy-3-(3-oxidobenzotriazol-3-ium-1-yl)propyl]-2,4-dimethyl-1H-pyrrole-3-carboxamide |
| SMILES | Cc1[nH]c(/C=C2\C(=O)Nc3ccc(Cl)cc32)c(C)c1C(=O)NCC(O)Cn1n[n+]([O-])c2ccccc21 |
| InChI | InChI=1S/C25H23ClN6O4/c1-13-20(10-18-17-9-15(26)7-8-19(17)29-24(18)34)28-14(2)23(13)25(35)27-11-16(33)12-31-21-5-3-4-6-22(21)32(36)30-31/h3-10,16,28,33H,11-12H2,1-2H3,(H,27,35)(H,29,34)/b18-10- |
| InChIKey | DWWADEITBSUIGT-ZDLGFXPLSA-N |
| XLogP | 2.55 |
| TPSA | 138.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.95 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|