C21H23ClN6O3 — CID 159350946
5-[(Z)-(5-chloro-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethyl-N-[3-(triazol-1-yl)propyl]-1H-pyrrole-3-carboxamide;hydrate (PubChem CID 159350946) has the molecular formula C21H23ClN6O3 and a molecular weight of 442.91 g/mol. Its IUPAC name is 5-[(Z)-(5-chloro-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethyl-N-[3-(triazol-1-yl)propyl]-1H-pyrrole-3-carboxamide;hydrate.
| Compound Name | 5-[(Z)-(5-chloro-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethyl-N-[3-(triazol-1-yl)propyl]-1H-pyrrole-3-carboxamide;hydrate |
|---|---|
| PubChem CID | 159350946 |
| Molecular Formula | C21H23ClN6O3 |
| Molecular Weight | 442.91 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | 5-[(Z)-(5-chloro-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethyl-N-[3-(triazol-1-yl)propyl]-1H-pyrrole-3-carboxamide;hydrate |
| SMILES | Cc1[nH]c(/C=C2\C(=O)Nc3ccc(Cl)cc32)c(C)c1C(=O)NCCCn1ccnn1.O |
| InChI | InChI=1S/C21H21ClN6O2.H2O/c1-12-18(11-16-15-10-14(22)4-5-17(15)26-20(16)29)25-13(2)19(12)21(30)23-6-3-8-28-9-7-24-27-28;/h4-5,7,9-11,25H,3,6,8H2,1-2H3,(H,23,30)(H,26,29);1H2/b16-11-; |
| InChIKey | WQGGECTUNPDBDV-MWVRIADDSA-N |
| XLogP | 2.36 |
| TPSA | 136.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.91 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|