C27H25ClN6O4S — CID 66605078
2-[(Z)-[5-[(3-chlorophenyl)methylsulfonyl]-2-oxo-1H-indol-3-ylidene]methyl]-5-methyl-N-[3-(triazol-1-yl)propyl]-1H-pyrrole-3-carboxamide (PubChem CID 66605078) has the molecular formula C27H25ClN6O4S and a molecular weight of 565.06 g/mol. Its IUPAC name is 2-[(Z)-[5-[(3-chlorophenyl)methylsulfonyl]-2-oxo-1H-indol-3-ylidene]methyl]-5-methyl-N-[3-(triazol-1-yl)propyl]-1H-pyrrole-3-carboxamide.
| Compound Name | 2-[(Z)-[5-[(3-chlorophenyl)methylsulfonyl]-2-oxo-1H-indol-3-ylidene]methyl]-5-methyl-N-[3-(triazol-1-yl)propyl]-1H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 66605078 |
| Molecular Formula | C27H25ClN6O4S |
| Molecular Weight | 565.06 g/mol |
| Exact Mass | 564.13 |
| IUPAC Name | 2-[(Z)-[5-[(3-chlorophenyl)methylsulfonyl]-2-oxo-1H-indol-3-ylidene]methyl]-5-methyl-N-[3-(triazol-1-yl)propyl]-1H-pyrrole-3-carboxamide |
| SMILES | Cc1cc(C(=O)NCCCn2ccnn2)c(/C=C2\C(=O)Nc3ccc(S(=O)(=O)Cc4cccc(Cl)c4)cc32)[nH]1 |
| InChI | InChI=1S/C27H25ClN6O4S/c1-17-12-23(26(35)29-8-3-10-34-11-9-30-33-34)25(31-17)15-22-21-14-20(6-7-24(21)32-27(22)36)39(37,38)16-18-4-2-5-19(28)13-18/h2,4-7,9,11-15,31H,3,8,10,16H2,1H3,(H,29,35)(H,32,36)/b22-15- |
| InChIKey | DZSNSFWWXQMSJJ-JCMHNJIXSA-N |
| XLogP | 3.85 |
| TPSA | 138.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.06 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|