C30H33N5O4S — CID 72509247
N-[2-(diethylamino)ethyl]-5-[[5-[(3-isocyanophenyl)methylsulfonyl]-2-oxo-1H-indol-3-ylidene]methyl]-2,4-dimethyl-1H-pyrrole-3-carboxamide (PubChem CID 72509247) has the molecular formula C30H33N5O4S and a molecular weight of 559.69 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-5-[[5-[(3-isocyanophenyl)methylsulfonyl]-2-oxo-1H-indol-3-ylidene]methyl]-2,4-dimethyl-1H-pyrrole-3-carboxamide.
| Compound Name | N-[2-(diethylamino)ethyl]-5-[[5-[(3-isocyanophenyl)methylsulfonyl]-2-oxo-1H-indol-3-ylidene]methyl]-2,4-dimethyl-1H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 72509247 |
| Molecular Formula | C30H33N5O4S |
| Molecular Weight | 559.69 g/mol |
| Exact Mass | 559.23 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-5-[[5-[(3-isocyanophenyl)methylsulfonyl]-2-oxo-1H-indol-3-ylidene]methyl]-2,4-dimethyl-1H-pyrrole-3-carboxamide |
| SMILES | [C-]#[N+]c1cccc(CS(=O)(=O)c2ccc3c(c2)C(=Cc2[nH]c(C)c(C(=O)NCCN(CC)CC)c2C)C(=O)N3)c1 |
| InChI | InChI=1S/C30H33N5O4S/c1-6-35(7-2)14-13-32-30(37)28-19(3)27(33-20(28)4)17-25-24-16-23(11-12-26(24)34-29(25)36)40(38,39)18-21-9-8-10-22(15-21)31-5/h8-12,15-17,33H,6-7,13-14,18H2,1-4H3,(H,32,37)(H,34,36) |
| InChIKey | XHIRAVPBUHZQOE-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.69 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|