C29H37FN4O4S — CID 59078875
N-[2-(diethylamino)ethyl]-5-[(Z)-[5-[[(2E,4Z,6E)-7-fluorohepta-2,4,6-trienyl]-dihydroxy-λ4-sulfanyl]-2-oxo-1H-indol-3-ylidene]methyl]-2,4-dimethyl-1H-pyrrole-3-carboxamide (PubChem CID 59078875) has the molecular formula C29H37FN4O4S and a molecular weight of 556.70 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-5-[(Z)-[5-[[(2E,4Z,6E)-7-fluorohepta-2,4,6-trienyl]-dihydroxy-λ4-sulfanyl]-2-oxo-1H-indol-3-ylidene]methyl]-2,4-dimethyl-1H-pyrrole-3-carboxamide.
| Compound Name | N-[2-(diethylamino)ethyl]-5-[(Z)-[5-[[(2E,4Z,6E)-7-fluorohepta-2,4,6-trienyl]-dihydroxy-λ4-sulfanyl]-2-oxo-1H-indol-3-ylidene]methyl]-2,4-dimethyl-1H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 59078875 |
| Molecular Formula | C29H37FN4O4S |
| Molecular Weight | 556.70 g/mol |
| Exact Mass | 556.25 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-5-[(Z)-[5-[[(2E,4Z,6E)-7-fluorohepta-2,4,6-trienyl]-dihydroxy-λ4-sulfanyl]-2-oxo-1H-indol-3-ylidene]methyl]-2,4-dimethyl-1H-pyrrole-3-carboxamide |
| SMILES | CCN(CC)CCNC(=O)c1c(C)[nH]c(/C=C2\C(=O)Nc3ccc(S(O)(O)C/C=C/C=C\C=C\F)cc32)c1C |
| InChI | InChI=1S/C29H37FN4O4S/c1-5-34(6-2)16-15-31-29(36)27-20(3)26(32-21(27)4)19-24-23-18-22(12-13-25(23)33-28(24)35)39(37,38)17-11-9-7-8-10-14-30/h7-14,18-19,32,37-38H,5-6,15-17H2,1-4H3,(H,31,36)(H,33,35)/b8-7-,11-9+,14-10+,24-19- |
| InChIKey | NBFXPRGRLUFJOG-BLOFCIIQSA-N |
| XLogP | 5.90 |
| TPSA | 117.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.70 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|