C29H33N5O7S — CID 72509283
N-[2-(diethylamino)ethyl]-5-[[5-[(2-hydroxy-5-nitrophenyl)methylsulfonyl]-2-oxo-1H-indol-3-ylidene]methyl]-2,4-dimethyl-1H-pyrrole-3-carboxamide (PubChem CID 72509283) has the molecular formula C29H33N5O7S and a molecular weight of 595.68 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-5-[[5-[(2-hydroxy-5-nitrophenyl)methylsulfonyl]-2-oxo-1H-indol-3-ylidene]methyl]-2,4-dimethyl-1H-pyrrole-3-carboxamide.
| Compound Name | N-[2-(diethylamino)ethyl]-5-[[5-[(2-hydroxy-5-nitrophenyl)methylsulfonyl]-2-oxo-1H-indol-3-ylidene]methyl]-2,4-dimethyl-1H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 72509283 |
| Molecular Formula | C29H33N5O7S |
| Molecular Weight | 595.68 g/mol |
| Exact Mass | 595.21 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-5-[[5-[(2-hydroxy-5-nitrophenyl)methylsulfonyl]-2-oxo-1H-indol-3-ylidene]methyl]-2,4-dimethyl-1H-pyrrole-3-carboxamide |
| SMILES | CCN(CC)CCNC(=O)c1c(C)[nH]c(C=C2C(=O)Nc3ccc(S(=O)(=O)Cc4cc([N+](=O)[O-])ccc4O)cc32)c1C |
| InChI | InChI=1S/C29H33N5O7S/c1-5-33(6-2)12-11-30-29(37)27-17(3)25(31-18(27)4)15-23-22-14-21(8-9-24(22)32-28(23)36)42(40,41)16-19-13-20(34(38)39)7-10-26(19)35/h7-10,13-15,31,35H,5-6,11-12,16H2,1-4H3,(H,30,37)(H,32,36) |
| InChIKey | CHNSDFXFWDMMIG-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 174.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.68 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|