C29H32N4O4S — CID 66605283
2-[(Z)-(5-benzylsulfonyl-2-oxo-1H-indol-3-ylidene)methyl]-5-methyl-N-(3-pyrrolidin-1-ylpropyl)-1H-pyrrole-3-carboxamide (PubChem CID 66605283) has the molecular formula C29H32N4O4S and a molecular weight of 532.67 g/mol. Its IUPAC name is 2-[(Z)-(5-benzylsulfonyl-2-oxo-1H-indol-3-ylidene)methyl]-5-methyl-N-(3-pyrrolidin-1-ylpropyl)-1H-pyrrole-3-carboxamide.
| Compound Name | 2-[(Z)-(5-benzylsulfonyl-2-oxo-1H-indol-3-ylidene)methyl]-5-methyl-N-(3-pyrrolidin-1-ylpropyl)-1H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 66605283 |
| Molecular Formula | C29H32N4O4S |
| Molecular Weight | 532.67 g/mol |
| Exact Mass | 532.21 |
| IUPAC Name | 2-[(Z)-(5-benzylsulfonyl-2-oxo-1H-indol-3-ylidene)methyl]-5-methyl-N-(3-pyrrolidin-1-ylpropyl)-1H-pyrrole-3-carboxamide |
| SMILES | Cc1cc(C(=O)NCCCN2CCCC2)c(/C=C2\C(=O)Nc3ccc(S(=O)(=O)Cc4ccccc4)cc32)[nH]1 |
| InChI | InChI=1S/C29H32N4O4S/c1-20-16-25(28(34)30-12-7-15-33-13-5-6-14-33)27(31-20)18-24-23-17-22(10-11-26(23)32-29(24)35)38(36,37)19-21-8-3-2-4-9-21/h2-4,8-11,16-18,31H,5-7,12-15,19H2,1H3,(H,30,34)(H,32,35)/b24-18- |
| InChIKey | CDNMWJOXSQSFIP-MOHJPFBDSA-N |
| XLogP | 4.01 |
| TPSA | 111.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.67 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|