C29H31FN4O4S — CID 66605704
2-[(Z)-[5-[(2-fluorophenyl)methylsulfonyl]-2-oxo-1H-indol-3-ylidene]methyl]-5-methyl-N-(3-pyrrolidin-1-ylpropyl)-1H-pyrrole-3-carboxamide (PubChem CID 66605704) has the molecular formula C29H31FN4O4S and a molecular weight of 550.66 g/mol. Its IUPAC name is 2-[(Z)-[5-[(2-fluorophenyl)methylsulfonyl]-2-oxo-1H-indol-3-ylidene]methyl]-5-methyl-N-(3-pyrrolidin-1-ylpropyl)-1H-pyrrole-3-carboxamide.
| Compound Name | 2-[(Z)-[5-[(2-fluorophenyl)methylsulfonyl]-2-oxo-1H-indol-3-ylidene]methyl]-5-methyl-N-(3-pyrrolidin-1-ylpropyl)-1H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 66605704 |
| Molecular Formula | C29H31FN4O4S |
| Molecular Weight | 550.66 g/mol |
| Exact Mass | 550.21 |
| IUPAC Name | 2-[(Z)-[5-[(2-fluorophenyl)methylsulfonyl]-2-oxo-1H-indol-3-ylidene]methyl]-5-methyl-N-(3-pyrrolidin-1-ylpropyl)-1H-pyrrole-3-carboxamide |
| SMILES | Cc1cc(C(=O)NCCCN2CCCC2)c(/C=C2\C(=O)Nc3ccc(S(=O)(=O)Cc4ccccc4F)cc32)[nH]1 |
| InChI | InChI=1S/C29H31FN4O4S/c1-19-15-24(28(35)31-11-6-14-34-12-4-5-13-34)27(32-19)17-23-22-16-21(9-10-26(22)33-29(23)36)39(37,38)18-20-7-2-3-8-25(20)30/h2-3,7-10,15-17,32H,4-6,11-14,18H2,1H3,(H,31,35)(H,33,36)/b23-17- |
| InChIKey | JLQHKPRRVQMWJI-QJOMJCCJSA-N |
| XLogP | 4.14 |
| TPSA | 111.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.66 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|