C28H30N4O4S — CID 72509202
2-[(5-benzylsulfonyl-2-oxo-1H-indol-3-ylidene)methyl]-5-methyl-N-(2-pyrrolidin-1-ylethyl)-1H-pyrrole-3-carboxamide (PubChem CID 72509202) has the molecular formula C28H30N4O4S and a molecular weight of 518.64 g/mol. Its IUPAC name is 2-[(5-benzylsulfonyl-2-oxo-1H-indol-3-ylidene)methyl]-5-methyl-N-(2-pyrrolidin-1-ylethyl)-1H-pyrrole-3-carboxamide.
| Compound Name | 2-[(5-benzylsulfonyl-2-oxo-1H-indol-3-ylidene)methyl]-5-methyl-N-(2-pyrrolidin-1-ylethyl)-1H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 72509202 |
| Molecular Formula | C28H30N4O4S |
| Molecular Weight | 518.64 g/mol |
| Exact Mass | 518.20 |
| IUPAC Name | 2-[(5-benzylsulfonyl-2-oxo-1H-indol-3-ylidene)methyl]-5-methyl-N-(2-pyrrolidin-1-ylethyl)-1H-pyrrole-3-carboxamide |
| SMILES | Cc1cc(C(=O)NCCN2CCCC2)c(C=C2C(=O)Nc3ccc(S(=O)(=O)Cc4ccccc4)cc32)[nH]1 |
| InChI | InChI=1S/C28H30N4O4S/c1-19-15-24(27(33)29-11-14-32-12-5-6-13-32)26(30-19)17-23-22-16-21(9-10-25(22)31-28(23)34)37(35,36)18-20-7-3-2-4-8-20/h2-4,7-10,15-17,30H,5-6,11-14,18H2,1H3,(H,29,33)(H,31,34) |
| InChIKey | SIJAQDOIHSVDKB-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 111.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.64 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|