C25H21ClN6O2 — CID 10183853
2-[(Z)-[4-(3-chlorophenyl)-2-oxo-1H-indol-3-ylidene]methyl]-5-methyl-N-[2-(triazol-1-yl)ethyl]-1H-pyrrole-3-carboxamide (PubChem CID 10183853) has the molecular formula C25H21ClN6O2 and a molecular weight of 472.94 g/mol. Its IUPAC name is 2-[(Z)-[4-(3-chlorophenyl)-2-oxo-1H-indol-3-ylidene]methyl]-5-methyl-N-[2-(triazol-1-yl)ethyl]-1H-pyrrole-3-carboxamide.
| Compound Name | 2-[(Z)-[4-(3-chlorophenyl)-2-oxo-1H-indol-3-ylidene]methyl]-5-methyl-N-[2-(triazol-1-yl)ethyl]-1H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 10183853 |
| Molecular Formula | C25H21ClN6O2 |
| Molecular Weight | 472.94 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | 2-[(Z)-[4-(3-chlorophenyl)-2-oxo-1H-indol-3-ylidene]methyl]-5-methyl-N-[2-(triazol-1-yl)ethyl]-1H-pyrrole-3-carboxamide |
| SMILES | Cc1cc(C(=O)NCCn2ccnn2)c(/C=C2\C(=O)Nc3cccc(-c4cccc(Cl)c4)c32)[nH]1 |
| InChI | InChI=1S/C25H21ClN6O2/c1-15-12-19(24(33)27-8-10-32-11-9-28-31-32)22(29-15)14-20-23-18(16-4-2-5-17(26)13-16)6-3-7-21(23)30-25(20)34/h2-7,9,11-14,29H,8,10H2,1H3,(H,27,33)(H,30,34)/b20-14- |
| InChIKey | QFBVFXVKRWTEDQ-ZHZULCJRSA-N |
| XLogP | 4.16 |
| TPSA | 104.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.94 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|