C19H13ClN2O — CID 59971441
(3Z)-4-(3-chlorophenyl)-3-(1H-pyrrol-2-ylmethylidene)-1H-indol-2-one (PubChem CID 59971441) has the molecular formula C19H13ClN2O and a molecular weight of 320.78 g/mol. Its IUPAC name is (3Z)-4-(3-chlorophenyl)-3-(1H-pyrrol-2-ylmethylidene)-1H-indol-2-one.
| Compound Name | (3Z)-4-(3-chlorophenyl)-3-(1H-pyrrol-2-ylmethylidene)-1H-indol-2-one |
|---|---|
| PubChem CID | 59971441 |
| Molecular Formula | C19H13ClN2O |
| Molecular Weight | 320.78 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | (3Z)-4-(3-chlorophenyl)-3-(1H-pyrrol-2-ylmethylidene)-1H-indol-2-one |
| SMILES | O=C1Nc2cccc(-c3cccc(Cl)c3)c2/C1=C/c1ccc[nH]1 |
| InChI | InChI=1S/C19H13ClN2O/c20-13-5-1-4-12(10-13)15-7-2-8-17-18(15)16(19(23)22-17)11-14-6-3-9-21-14/h1-11,21H,(H,22,23)/b16-11- |
| InChIKey | XYSHPKHFHIMWMS-WJDWOHSUSA-N |
| XLogP | 4.83 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.78 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|