C26H26N4O2 — CID 54175365
4-amino-N-[3-[2-oxo-3-(1H-pyrrol-2-ylmethylidene)-1H-indol-4-yl]phenyl]cyclohexane-1-carboxamide (PubChem CID 54175365) has the molecular formula C26H26N4O2 and a molecular weight of 426.52 g/mol. Its IUPAC name is 4-amino-N-[3-[2-oxo-3-(1H-pyrrol-2-ylmethylidene)-1H-indol-4-yl]phenyl]cyclohexane-1-carboxamide.
| Compound Name | 4-amino-N-[3-[2-oxo-3-(1H-pyrrol-2-ylmethylidene)-1H-indol-4-yl]phenyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 54175365 |
| Molecular Formula | C26H26N4O2 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | 4-amino-N-[3-[2-oxo-3-(1H-pyrrol-2-ylmethylidene)-1H-indol-4-yl]phenyl]cyclohexane-1-carboxamide |
| SMILES | NC1CCC(C(=O)Nc2cccc(-c3cccc4c3C(=Cc3ccc[nH]3)C(=O)N4)c2)CC1 |
| InChI | InChI=1S/C26H26N4O2/c27-18-11-9-16(10-12-18)25(31)29-20-5-1-4-17(14-20)21-7-2-8-23-24(21)22(26(32)30-23)15-19-6-3-13-28-19/h1-8,13-16,18,28H,9-12,27H2,(H,29,31)(H,30,32) |
| InChIKey | OXYFCYJKJVYXPC-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 100.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|