C32H28F3N5O2 — CID 59804350
3-(4-methylpiperazin-1-yl)-N-[3-[(3Z)-2-oxo-3-(1H-pyrrol-2-ylmethylidene)-1H-indol-6-yl]phenyl]-5-(trifluoromethyl)benzamide (PubChem CID 59804350) has the molecular formula C32H28F3N5O2 and a molecular weight of 571.60 g/mol. Its IUPAC name is 3-(4-methylpiperazin-1-yl)-N-[3-[(3Z)-2-oxo-3-(1H-pyrrol-2-ylmethylidene)-1H-indol-6-yl]phenyl]-5-(trifluoromethyl)benzamide.
| Compound Name | 3-(4-methylpiperazin-1-yl)-N-[3-[(3Z)-2-oxo-3-(1H-pyrrol-2-ylmethylidene)-1H-indol-6-yl]phenyl]-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 59804350 |
| Molecular Formula | C32H28F3N5O2 |
| Molecular Weight | 571.60 g/mol |
| Exact Mass | 571.22 |
| IUPAC Name | 3-(4-methylpiperazin-1-yl)-N-[3-[(3Z)-2-oxo-3-(1H-pyrrol-2-ylmethylidene)-1H-indol-6-yl]phenyl]-5-(trifluoromethyl)benzamide |
| SMILES | CN1CCN(c2cc(C(=O)Nc3cccc(-c4ccc5c(c4)NC(=O)/C5=C\c4ccc[nH]4)c3)cc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C32H28F3N5O2/c1-39-10-12-40(13-11-39)26-16-22(14-23(18-26)32(33,34)35)30(41)37-25-5-2-4-20(15-25)21-7-8-27-28(19-24-6-3-9-36-24)31(42)38-29(27)17-21/h2-9,14-19,36H,10-13H2,1H3,(H,37,41)(H,38,42)/b28-19- |
| InChIKey | LPHLNWAJEULBLZ-USHMODERSA-N |
| XLogP | 6.20 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.60 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|