C35H25F3N6O2 — CID 59804347
N-[3-[[(3Z)-3-(1H-indol-3-ylmethylidene)-2-oxo-1H-indol-6-yl]amino]phenyl]-3-(4-methylimidazol-1-yl)-5-(trifluoromethyl)benzamide (PubChem CID 59804347) has the molecular formula C35H25F3N6O2 and a molecular weight of 618.62 g/mol. Its IUPAC name is N-[3-[[(3Z)-3-(1H-indol-3-ylmethylidene)-2-oxo-1H-indol-6-yl]amino]phenyl]-3-(4-methylimidazol-1-yl)-5-(trifluoromethyl)benzamide.
| Compound Name | N-[3-[[(3Z)-3-(1H-indol-3-ylmethylidene)-2-oxo-1H-indol-6-yl]amino]phenyl]-3-(4-methylimidazol-1-yl)-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 59804347 |
| Molecular Formula | C35H25F3N6O2 |
| Molecular Weight | 618.62 g/mol |
| Exact Mass | 618.20 |
| IUPAC Name | N-[3-[[(3Z)-3-(1H-indol-3-ylmethylidene)-2-oxo-1H-indol-6-yl]amino]phenyl]-3-(4-methylimidazol-1-yl)-5-(trifluoromethyl)benzamide |
| SMILES | Cc1cn(-c2cc(C(=O)Nc3cccc(Nc4ccc5c(c4)NC(=O)/C5=C\c4c[nH]c5ccccc45)c3)cc(C(F)(F)F)c2)cn1 |
| InChI | InChI=1S/C35H25F3N6O2/c1-20-18-44(19-40-20)27-12-21(11-23(14-27)35(36,37)38)33(45)42-25-6-4-5-24(15-25)41-26-9-10-29-30(34(46)43-32(29)16-26)13-22-17-39-31-8-3-2-7-28(22)31/h2-19,39,41H,1H3,(H,42,45)(H,43,46)/b30-13- |
| InChIKey | AOERNQTXCBAACN-YNFMAFFXSA-N |
| XLogP | 8.17 |
| TPSA | 103.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.62 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_L(4)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|