C33H25F3N6O4 — CID 66676119
methyl 4-[[6-[3-[[3-(4-methylimidazol-1-yl)-5-(trifluoromethyl)benzoyl]amino]anilino]-2-oxo-1H-indol-3-ylidene]methyl]-1H-pyrrole-2-carboxylate (PubChem CID 66676119) has the molecular formula C33H25F3N6O4 and a molecular weight of 626.60 g/mol. Its IUPAC name is methyl 4-[[6-[3-[[3-(4-methylimidazol-1-yl)-5-(trifluoromethyl)benzoyl]amino]anilino]-2-oxo-1H-indol-3-ylidene]methyl]-1H-pyrrole-2-carboxylate.
| Compound Name | methyl 4-[[6-[3-[[3-(4-methylimidazol-1-yl)-5-(trifluoromethyl)benzoyl]amino]anilino]-2-oxo-1H-indol-3-ylidene]methyl]-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 66676119 |
| Molecular Formula | C33H25F3N6O4 |
| Molecular Weight | 626.60 g/mol |
| Exact Mass | 626.19 |
| IUPAC Name | methyl 4-[[6-[3-[[3-(4-methylimidazol-1-yl)-5-(trifluoromethyl)benzoyl]amino]anilino]-2-oxo-1H-indol-3-ylidene]methyl]-1H-pyrrole-2-carboxylate |
| SMILES | COC(=O)c1cc(C=C2C(=O)Nc3cc(Nc4cccc(NC(=O)c5cc(-n6cnc(C)c6)cc(C(F)(F)F)c5)c4)ccc32)c[nH]1 |
| InChI | InChI=1S/C33H25F3N6O4/c1-18-16-42(17-38-18)25-11-20(10-21(12-25)33(34,35)36)30(43)40-23-5-3-4-22(13-23)39-24-6-7-26-27(31(44)41-28(26)14-24)8-19-9-29(37-15-19)32(45)46-2/h3-17,37,39H,1-2H3,(H,40,43)(H,41,44) |
| InChIKey | ILORFIMBIUYEHU-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 130.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.60 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_L(4)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|