C34H35F3N6O2 — CID 66674870
N-[3-[[3-[[4-[[2-(diethylamino)ethylamino]methyl]-1H-pyrrol-2-yl]methylidene]-2-oxo-1H-indol-6-yl]amino]phenyl]-3-(trifluoromethyl)benzamide (PubChem CID 66674870) has the molecular formula C34H35F3N6O2 and a molecular weight of 616.69 g/mol. Its IUPAC name is N-[3-[[3-[[4-[[2-(diethylamino)ethylamino]methyl]-1H-pyrrol-2-yl]methylidene]-2-oxo-1H-indol-6-yl]amino]phenyl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[3-[[3-[[4-[[2-(diethylamino)ethylamino]methyl]-1H-pyrrol-2-yl]methylidene]-2-oxo-1H-indol-6-yl]amino]phenyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 66674870 |
| Molecular Formula | C34H35F3N6O2 |
| Molecular Weight | 616.69 g/mol |
| Exact Mass | 616.28 |
| IUPAC Name | N-[3-[[3-[[4-[[2-(diethylamino)ethylamino]methyl]-1H-pyrrol-2-yl]methylidene]-2-oxo-1H-indol-6-yl]amino]phenyl]-3-(trifluoromethyl)benzamide |
| SMILES | CCN(CC)CCNCc1c[nH]c(C=C2C(=O)Nc3cc(Nc4cccc(NC(=O)c5cccc(C(F)(F)F)c5)c4)ccc32)c1 |
| InChI | InChI=1S/C34H35F3N6O2/c1-3-43(4-2)14-13-38-20-22-15-28(39-21-22)18-30-29-12-11-27(19-31(29)42-33(30)45)40-25-9-6-10-26(17-25)41-32(44)23-7-5-8-24(16-23)34(35,36)37/h5-12,15-19,21,38-40H,3-4,13-14,20H2,1-2H3,(H,41,44)(H,42,45) |
| InChIKey | WZGNSSCFKGQLDE-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.69 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|