C28H18F3N3O5 — CID 66675284
5-[[2-oxo-6-[3-[[3-(trifluoromethyl)benzoyl]amino]phenoxy]-1H-indol-3-ylidene]methyl]-1H-pyrrole-3-carboxylic acid (PubChem CID 66675284) has the molecular formula C28H18F3N3O5 and a molecular weight of 533.46 g/mol. Its IUPAC name is 5-[[2-oxo-6-[3-[[3-(trifluoromethyl)benzoyl]amino]phenoxy]-1H-indol-3-ylidene]methyl]-1H-pyrrole-3-carboxylic acid.
| Compound Name | 5-[[2-oxo-6-[3-[[3-(trifluoromethyl)benzoyl]amino]phenoxy]-1H-indol-3-ylidene]methyl]-1H-pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 66675284 |
| Molecular Formula | C28H18F3N3O5 |
| Molecular Weight | 533.46 g/mol |
| Exact Mass | 533.12 |
| IUPAC Name | 5-[[2-oxo-6-[3-[[3-(trifluoromethyl)benzoyl]amino]phenoxy]-1H-indol-3-ylidene]methyl]-1H-pyrrole-3-carboxylic acid |
| SMILES | O=C1Nc2cc(Oc3cccc(NC(=O)c4cccc(C(F)(F)F)c4)c3)ccc2C1=Cc1cc(C(=O)O)c[nH]1 |
| InChI | InChI=1S/C28H18F3N3O5/c29-28(30,31)17-4-1-3-15(9-17)25(35)33-18-5-2-6-20(11-18)39-21-7-8-22-23(26(36)34-24(22)13-21)12-19-10-16(14-32-19)27(37)38/h1-14,32H,(H,33,35)(H,34,36)(H,37,38) |
| InChIKey | JIHWUALMQRMTCD-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 120.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.46 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|