C21H15ClN2O3 — CID 72637622
2-[[4-(4-chlorophenyl)-2-oxo-1H-indol-3-ylidene]methyl]-5-methyl-1H-pyrrole-3-carboxylic acid (PubChem CID 72637622) has the molecular formula C21H15ClN2O3 and a molecular weight of 378.82 g/mol. Its IUPAC name is 2-[[4-(4-chlorophenyl)-2-oxo-1H-indol-3-ylidene]methyl]-5-methyl-1H-pyrrole-3-carboxylic acid.
| Compound Name | 2-[[4-(4-chlorophenyl)-2-oxo-1H-indol-3-ylidene]methyl]-5-methyl-1H-pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 72637622 |
| Molecular Formula | C21H15ClN2O3 |
| Molecular Weight | 378.82 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | 2-[[4-(4-chlorophenyl)-2-oxo-1H-indol-3-ylidene]methyl]-5-methyl-1H-pyrrole-3-carboxylic acid |
| SMILES | Cc1cc(C(=O)O)c(C=C2C(=O)Nc3cccc(-c4ccc(Cl)cc4)c32)[nH]1 |
| InChI | InChI=1S/C21H15ClN2O3/c1-11-9-15(21(26)27)18(23-11)10-16-19-14(12-5-7-13(22)8-6-12)3-2-4-17(19)24-20(16)25/h2-10,23H,1H3,(H,24,25)(H,26,27) |
| InChIKey | RVOWJZLADJNHCB-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.82 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|