C27H27ClN4O2 — CID 10162527
(3Z)-4-(4-chlorophenyl)-3-[[3,5-dimethyl-4-(4-methylpiperazine-1-carbonyl)-1H-pyrrol-2-yl]methylidene]-1H-indol-2-one (PubChem CID 10162527) has the molecular formula C27H27ClN4O2 and a molecular weight of 474.99 g/mol. Its IUPAC name is (3Z)-4-(4-chlorophenyl)-3-[[3,5-dimethyl-4-(4-methylpiperazine-1-carbonyl)-1H-pyrrol-2-yl]methylidene]-1H-indol-2-one.
| Compound Name | (3Z)-4-(4-chlorophenyl)-3-[[3,5-dimethyl-4-(4-methylpiperazine-1-carbonyl)-1H-pyrrol-2-yl]methylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 10162527 |
| Molecular Formula | C27H27ClN4O2 |
| Molecular Weight | 474.99 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | (3Z)-4-(4-chlorophenyl)-3-[[3,5-dimethyl-4-(4-methylpiperazine-1-carbonyl)-1H-pyrrol-2-yl]methylidene]-1H-indol-2-one |
| SMILES | Cc1[nH]c(/C=C2\C(=O)Nc3cccc(-c4ccc(Cl)cc4)c32)c(C)c1C(=O)N1CCN(C)CC1 |
| InChI | InChI=1S/C27H27ClN4O2/c1-16-23(29-17(2)24(16)27(34)32-13-11-31(3)12-14-32)15-21-25-20(18-7-9-19(28)10-8-18)5-4-6-22(25)30-26(21)33/h4-10,15,29H,11-14H2,1-3H3,(H,30,33)/b21-15- |
| InChIKey | KCOSXZYTSFJIAQ-QNGOZBTKSA-N |
| XLogP | 4.83 |
| TPSA | 68.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.99 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|