C27H27FN4O2 — CID 24942647
3-[[3,5-dimethyl-4-(4-methylpiperazine-1-carbonyl)-1H-pyrrol-2-yl]methylidene]-4-(3-fluorophenyl)-1H-indol-2-one (PubChem CID 24942647) has the molecular formula C27H27FN4O2 and a molecular weight of 458.54 g/mol. Its IUPAC name is 3-[[3,5-dimethyl-4-(4-methylpiperazine-1-carbonyl)-1H-pyrrol-2-yl]methylidene]-4-(3-fluorophenyl)-1H-indol-2-one.
| Compound Name | 3-[[3,5-dimethyl-4-(4-methylpiperazine-1-carbonyl)-1H-pyrrol-2-yl]methylidene]-4-(3-fluorophenyl)-1H-indol-2-one |
|---|---|
| PubChem CID | 24942647 |
| Molecular Formula | C27H27FN4O2 |
| Molecular Weight | 458.54 g/mol |
| Exact Mass | 458.21 |
| IUPAC Name | 3-[[3,5-dimethyl-4-(4-methylpiperazine-1-carbonyl)-1H-pyrrol-2-yl]methylidene]-4-(3-fluorophenyl)-1H-indol-2-one |
| SMILES | Cc1[nH]c(C=C2C(=O)Nc3cccc(-c4cccc(F)c4)c32)c(C)c1C(=O)N1CCN(C)CC1 |
| InChI | InChI=1S/C27H27FN4O2/c1-16-23(29-17(2)24(16)27(34)32-12-10-31(3)11-13-32)15-21-25-20(18-6-4-7-19(28)14-18)8-5-9-22(25)30-26(21)33/h4-9,14-15,29H,10-13H2,1-3H3,(H,30,33) |
| InChIKey | YVIDARGTGQKWAU-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 68.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.54 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|