C31H37FN4O2 — CID 142153465
ethane;2-[(Z)-[4-(3-fluorophenyl)-2-oxo-1H-indol-3-ylidene]methyl]-4,5-dimethyl-N-(3-pyrrolidin-1-ylpropyl)-1H-pyrrole-3-carboxamide (PubChem CID 142153465) has the molecular formula C31H37FN4O2 and a molecular weight of 516.66 g/mol. Its IUPAC name is ethane;2-[(Z)-[4-(3-fluorophenyl)-2-oxo-1H-indol-3-ylidene]methyl]-4,5-dimethyl-N-(3-pyrrolidin-1-ylpropyl)-1H-pyrrole-3-carboxamide.
| Compound Name | ethane;2-[(Z)-[4-(3-fluorophenyl)-2-oxo-1H-indol-3-ylidene]methyl]-4,5-dimethyl-N-(3-pyrrolidin-1-ylpropyl)-1H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 142153465 |
| Molecular Formula | C31H37FN4O2 |
| Molecular Weight | 516.66 g/mol |
| Exact Mass | 516.29 |
| IUPAC Name | ethane;2-[(Z)-[4-(3-fluorophenyl)-2-oxo-1H-indol-3-ylidene]methyl]-4,5-dimethyl-N-(3-pyrrolidin-1-ylpropyl)-1H-pyrrole-3-carboxamide |
| SMILES | CC.Cc1[nH]c(/C=C2\C(=O)Nc3cccc(-c4cccc(F)c4)c32)c(C(=O)NCCCN2CCCC2)c1C |
| InChI | InChI=1S/C29H31FN4O2.C2H6/c1-18-19(2)32-25(26(18)29(36)31-12-7-15-34-13-3-4-14-34)17-23-27-22(20-8-5-9-21(30)16-20)10-6-11-24(27)33-28(23)35;1-2/h5-6,8-11,16-17,32H,3-4,7,12-15H2,1-2H3,(H,31,36)(H,33,35);1-2H3/b23-17-; |
| InChIKey | OGOWQVICXGXTRZ-AHKBEGBGSA-N |
| XLogP | 6.17 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.66 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|