C25H20ClN3O4Se — CID 71659989
2-(3-oxo-1,2-benzoselenazol-2-yl)ethyl 5-[(Z)-(5-chloro-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethyl-1H-pyrrole-3-carboxylate (PubChem CID 71659989) has the molecular formula C25H20ClN3O4Se and a molecular weight of 540.87 g/mol. Its IUPAC name is 2-(3-oxo-1,2-benzoselenazol-2-yl)ethyl 5-[(Z)-(5-chloro-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethyl-1H-pyrrole-3-carboxylate.
| Compound Name | 2-(3-oxo-1,2-benzoselenazol-2-yl)ethyl 5-[(Z)-(5-chloro-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethyl-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 71659989 |
| Molecular Formula | C25H20ClN3O4Se |
| Molecular Weight | 540.87 g/mol |
| Exact Mass | 541.03 |
| IUPAC Name | 2-(3-oxo-1,2-benzoselenazol-2-yl)ethyl 5-[(Z)-(5-chloro-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethyl-1H-pyrrole-3-carboxylate |
| SMILES | Cc1[nH]c(/C=C2\C(=O)Nc3ccc(Cl)cc32)c(C)c1C(=O)OCCn1[se]c2ccccc2c1=O |
| InChI | InChI=1S/C25H20ClN3O4Se/c1-13-20(12-18-17-11-15(26)7-8-19(17)28-23(18)30)27-14(2)22(13)25(32)33-10-9-29-24(31)16-5-3-4-6-21(16)34-29/h3-8,11-12,27H,9-10H2,1-2H3,(H,28,30)/b18-12- |
| InChIKey | SQOLJZINJNAZCT-PDGQHHTCSA-N |
| XLogP | 4.01 |
| TPSA | 93.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.87 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|