C25H19F2N3O4Se — CID 86566941
2-(5-fluoro-3-oxo-1,2-benzoselenazol-2-yl)ethyl 5-[(E)-(7-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethyl-1H-pyrrole-3-carboxylate (PubChem CID 86566941) has the molecular formula C25H19F2N3O4Se and a molecular weight of 542.40 g/mol. Its IUPAC name is 2-(5-fluoro-3-oxo-1,2-benzoselenazol-2-yl)ethyl 5-[(E)-(7-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethyl-1H-pyrrole-3-carboxylate.
| Compound Name | 2-(5-fluoro-3-oxo-1,2-benzoselenazol-2-yl)ethyl 5-[(E)-(7-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethyl-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 86566941 |
| Molecular Formula | C25H19F2N3O4Se |
| Molecular Weight | 542.40 g/mol |
| Exact Mass | 543.05 |
| IUPAC Name | 2-(5-fluoro-3-oxo-1,2-benzoselenazol-2-yl)ethyl 5-[(E)-(7-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethyl-1H-pyrrole-3-carboxylate |
| SMILES | Cc1[nH]c(/C=C2/C(=O)Nc3c(F)cccc32)c(C)c1C(=O)OCCn1[se]c2ccc(F)cc2c1=O |
| InChI | InChI=1S/C25H19F2N3O4Se/c1-12-19(11-16-15-4-3-5-18(27)22(15)29-23(16)31)28-13(2)21(12)25(33)34-9-8-30-24(32)17-10-14(26)6-7-20(17)35-30/h3-7,10-11,28H,8-9H2,1-2H3,(H,29,31)/b16-11+ |
| InChIKey | VCNJBWWNZQZBSM-LFIBNONCSA-N |
| XLogP | 3.63 |
| TPSA | 93.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.40 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|