C26H23N3O5Se — CID 71659993
2-(3-oxo-1,2-benzoselenazol-2-yl)ethyl 5-[(Z)-(5-methoxy-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethyl-1H-pyrrole-3-carboxylate (PubChem CID 71659993) has the molecular formula C26H23N3O5Se and a molecular weight of 536.45 g/mol. Its IUPAC name is 2-(3-oxo-1,2-benzoselenazol-2-yl)ethyl 5-[(Z)-(5-methoxy-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethyl-1H-pyrrole-3-carboxylate.
| Compound Name | 2-(3-oxo-1,2-benzoselenazol-2-yl)ethyl 5-[(Z)-(5-methoxy-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethyl-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 71659993 |
| Molecular Formula | C26H23N3O5Se |
| Molecular Weight | 536.45 g/mol |
| Exact Mass | 537.08 |
| IUPAC Name | 2-(3-oxo-1,2-benzoselenazol-2-yl)ethyl 5-[(Z)-(5-methoxy-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethyl-1H-pyrrole-3-carboxylate |
| SMILES | COc1ccc2c(c1)/C(=C/c1[nH]c(C)c(C(=O)OCCn3[se]c4ccccc4c3=O)c1C)C(=O)N2 |
| InChI | InChI=1S/C26H23N3O5Se/c1-14-21(13-19-18-12-16(33-3)8-9-20(18)28-24(19)30)27-15(2)23(14)26(32)34-11-10-29-25(31)17-6-4-5-7-22(17)35-29/h4-9,12-13,27H,10-11H2,1-3H3,(H,28,30)/b19-13- |
| InChIKey | NMVSNQOTENTWGO-UYRXBGFRSA-N |
| XLogP | 3.36 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.45 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|