C22H18N2O3 — CID 68789954
2,4-dimethyl-5-[(2-oxo-5-phenyl-1H-indol-3-ylidene)methyl]-1H-pyrrole-3-carboxylic acid (PubChem CID 68789954) has the molecular formula C22H18N2O3 and a molecular weight of 358.40 g/mol. Its IUPAC name is 2,4-dimethyl-5-[(2-oxo-5-phenyl-1H-indol-3-ylidene)methyl]-1H-pyrrole-3-carboxylic acid.
| Compound Name | 2,4-dimethyl-5-[(2-oxo-5-phenyl-1H-indol-3-ylidene)methyl]-1H-pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 68789954 |
| Molecular Formula | C22H18N2O3 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | 2,4-dimethyl-5-[(2-oxo-5-phenyl-1H-indol-3-ylidene)methyl]-1H-pyrrole-3-carboxylic acid |
| SMILES | Cc1[nH]c(C=C2C(=O)Nc3ccc(-c4ccccc4)cc32)c(C)c1C(=O)O |
| InChI | InChI=1S/C22H18N2O3/c1-12-19(23-13(2)20(12)22(26)27)11-17-16-10-15(14-6-4-3-5-7-14)8-9-18(16)24-21(17)25/h3-11,23H,1-2H3,(H,24,25)(H,26,27) |
| InChIKey | VPBHVFNUWSDLJM-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|