C29H31N3O2 — CID 158281530
(3Z)-3-[[3,5-dimethyl-4-(4-pyrrolidin-1-ylbutanoyl)-1H-pyrrol-2-yl]methylidene]-6-phenyl-1H-indol-2-one (PubChem CID 158281530) has the molecular formula C29H31N3O2 and a molecular weight of 453.59 g/mol. Its IUPAC name is (3Z)-3-[[3,5-dimethyl-4-(4-pyrrolidin-1-ylbutanoyl)-1H-pyrrol-2-yl]methylidene]-6-phenyl-1H-indol-2-one.
| Compound Name | (3Z)-3-[[3,5-dimethyl-4-(4-pyrrolidin-1-ylbutanoyl)-1H-pyrrol-2-yl]methylidene]-6-phenyl-1H-indol-2-one |
|---|---|
| PubChem CID | 158281530 |
| Molecular Formula | C29H31N3O2 |
| Molecular Weight | 453.59 g/mol |
| Exact Mass | 453.24 |
| IUPAC Name | (3Z)-3-[[3,5-dimethyl-4-(4-pyrrolidin-1-ylbutanoyl)-1H-pyrrol-2-yl]methylidene]-6-phenyl-1H-indol-2-one |
| SMILES | Cc1[nH]c(/C=C2\C(=O)Nc3cc(-c4ccccc4)ccc32)c(C)c1C(=O)CCCN1CCCC1 |
| InChI | InChI=1S/C29H31N3O2/c1-19-25(30-20(2)28(19)27(33)11-8-16-32-14-6-7-15-32)18-24-23-13-12-22(17-26(23)31-29(24)34)21-9-4-3-5-10-21/h3-5,9-10,12-13,17-18,30H,6-8,11,14-16H2,1-2H3,(H,31,34)/b24-18- |
| InChIKey | GKGSGYTVNVDECY-MOHJPFBDSA-N |
| XLogP | 5.85 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.59 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|