C24H20N4O5 — CID 123598424
5-[[6-(benzoylcarbamoylamino)-2-oxo-1H-indol-3-ylidene]methyl]-2,4-dimethyl-1H-pyrrole-3-carboxylic acid (PubChem CID 123598424) has the molecular formula C24H20N4O5 and a molecular weight of 444.45 g/mol. Its IUPAC name is 5-[[6-(benzoylcarbamoylamino)-2-oxo-1H-indol-3-ylidene]methyl]-2,4-dimethyl-1H-pyrrole-3-carboxylic acid.
| Compound Name | 5-[[6-(benzoylcarbamoylamino)-2-oxo-1H-indol-3-ylidene]methyl]-2,4-dimethyl-1H-pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 123598424 |
| Molecular Formula | C24H20N4O5 |
| Molecular Weight | 444.45 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | 5-[[6-(benzoylcarbamoylamino)-2-oxo-1H-indol-3-ylidene]methyl]-2,4-dimethyl-1H-pyrrole-3-carboxylic acid |
| SMILES | Cc1[nH]c(C=C2C(=O)Nc3cc(NC(=O)NC(=O)c4ccccc4)ccc32)c(C)c1C(=O)O |
| InChI | InChI=1S/C24H20N4O5/c1-12-18(25-13(2)20(12)23(31)32)11-17-16-9-8-15(10-19(16)27-22(17)30)26-24(33)28-21(29)14-6-4-3-5-7-14/h3-11,25H,1-2H3,(H,27,30)(H,31,32)(H2,26,28,29,33) |
| InChIKey | AKENPLCIWTVVIL-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 140.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.45 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|