C29H24N4O4 — CID 68871748
5-[[7-(3-benzamidoanilino)-2-oxo-1H-indol-3-ylidene]methyl]-2,4-dimethyl-1H-pyrrole-3-carboxylic acid (PubChem CID 68871748) has the molecular formula C29H24N4O4 and a molecular weight of 492.54 g/mol. Its IUPAC name is 5-[[7-(3-benzamidoanilino)-2-oxo-1H-indol-3-ylidene]methyl]-2,4-dimethyl-1H-pyrrole-3-carboxylic acid.
| Compound Name | 5-[[7-(3-benzamidoanilino)-2-oxo-1H-indol-3-ylidene]methyl]-2,4-dimethyl-1H-pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 68871748 |
| Molecular Formula | C29H24N4O4 |
| Molecular Weight | 492.54 g/mol |
| Exact Mass | 492.18 |
| IUPAC Name | 5-[[7-(3-benzamidoanilino)-2-oxo-1H-indol-3-ylidene]methyl]-2,4-dimethyl-1H-pyrrole-3-carboxylic acid |
| SMILES | Cc1[nH]c(C=C2C(=O)Nc3c(Nc4cccc(NC(=O)c5ccccc5)c4)cccc32)c(C)c1C(=O)O |
| InChI | InChI=1S/C29H24N4O4/c1-16-24(30-17(2)25(16)29(36)37)15-22-21-12-7-13-23(26(21)33-28(22)35)31-19-10-6-11-20(14-19)32-27(34)18-8-4-3-5-9-18/h3-15,30-31H,1-2H3,(H,32,34)(H,33,35)(H,36,37) |
| InChIKey | NPVFHOBMSBQKFC-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 123.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.54 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|