C21H23N3O2 — CID 137464662
N-[6-(2-aminoanilino)-6-oxohexyl]-4-ethynylbenzamide (PubChem CID 137464662) has the molecular formula C21H23N3O2 and a molecular weight of 349.43 g/mol. Its IUPAC name is N-[6-(2-aminoanilino)-6-oxohexyl]-4-ethynylbenzamide.
| Compound Name | N-[6-(2-aminoanilino)-6-oxohexyl]-4-ethynylbenzamide |
|---|---|
| PubChem CID | 137464662 |
| Molecular Formula | C21H23N3O2 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | N-[6-(2-aminoanilino)-6-oxohexyl]-4-ethynylbenzamide |
| SMILES | C#Cc1ccc(C(=O)NCCCCCC(=O)Nc2ccccc2N)cc1 |
| InChI | InChI=1S/C21H23N3O2/c1-2-16-11-13-17(14-12-16)21(26)23-15-7-3-4-10-20(25)24-19-9-6-5-8-18(19)22/h1,5-6,8-9,11-14H,3-4,7,10,15,22H2,(H,23,26)(H,24,25) |
| InChIKey | DAHVOOGYBNVIJR-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|