C28H28N4O2 — CID 135869613
N-(2-aminophenyl)-6-[6-oxo-4-(4-phenylphenyl)-1H-pyrimidin-2-yl]hexanamide (PubChem CID 135869613) has the molecular formula C28H28N4O2 and a molecular weight of 452.56 g/mol. Its IUPAC name is N-(2-aminophenyl)-6-[6-oxo-4-(4-phenylphenyl)-1H-pyrimidin-2-yl]hexanamide.
| Compound Name | N-(2-aminophenyl)-6-[6-oxo-4-(4-phenylphenyl)-1H-pyrimidin-2-yl]hexanamide |
|---|---|
| PubChem CID | 135869613 |
| Molecular Formula | C28H28N4O2 |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.22 |
| IUPAC Name | N-(2-aminophenyl)-6-[6-oxo-4-(4-phenylphenyl)-1H-pyrimidin-2-yl]hexanamide |
| SMILES | Nc1ccccc1NC(=O)CCCCCc1nc(-c2ccc(-c3ccccc3)cc2)cc(=O)[nH]1 |
| InChI | InChI=1S/C28H28N4O2/c29-23-11-7-8-12-24(23)31-27(33)14-6-2-5-13-26-30-25(19-28(34)32-26)22-17-15-21(16-18-22)20-9-3-1-4-10-20/h1,3-4,7-12,15-19H,2,5-6,13-14,29H2,(H,31,33)(H,30,32,34) |
| InChIKey | QJKSPKFVGMKVAJ-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|