C17H16F2N2O2 — CID 39753880
N-[4-(2,5-difluoroanilino)-4-oxobutyl]benzamide (PubChem CID 39753880) has the molecular formula C17H16F2N2O2 and a molecular weight of 318.32 g/mol. Its IUPAC name is N-[4-(2,5-difluoroanilino)-4-oxobutyl]benzamide.
| Compound Name | N-[4-(2,5-difluoroanilino)-4-oxobutyl]benzamide |
|---|---|
| PubChem CID | 39753880 |
| Molecular Formula | C17H16F2N2O2 |
| Molecular Weight | 318.32 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | N-[4-(2,5-difluoroanilino)-4-oxobutyl]benzamide |
| SMILES | O=C(CCCNC(=O)c1ccccc1)Nc1cc(F)ccc1F |
| InChI | InChI=1S/C17H16F2N2O2/c18-13-8-9-14(19)15(11-13)21-16(22)7-4-10-20-17(23)12-5-2-1-3-6-12/h1-3,5-6,8-9,11H,4,7,10H2,(H,20,23)(H,21,22) |
| InChIKey | OIZLMDKXCZZMES-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.32 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|