C27H36N4O4 — CID 155469202
tert-butyl N-[[2-[4-[4-[4-(propanoylamino)phenyl]butanoylamino]phenyl]cyclopropyl]amino]carbamate (PubChem CID 155469202) has the molecular formula C27H36N4O4 and a molecular weight of 480.61 g/mol. Its IUPAC name is tert-butyl N-[[2-[4-[4-[4-(propanoylamino)phenyl]butanoylamino]phenyl]cyclopropyl]amino]carbamate.
| Compound Name | tert-butyl N-[[2-[4-[4-[4-(propanoylamino)phenyl]butanoylamino]phenyl]cyclopropyl]amino]carbamate |
|---|---|
| PubChem CID | 155469202 |
| Molecular Formula | C27H36N4O4 |
| Molecular Weight | 480.61 g/mol |
| Exact Mass | 480.27 |
| IUPAC Name | tert-butyl N-[[2-[4-[4-[4-(propanoylamino)phenyl]butanoylamino]phenyl]cyclopropyl]amino]carbamate |
| SMILES | CCC(=O)Nc1ccc(CCCC(=O)Nc2ccc(C3CC3NNC(=O)OC(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C27H36N4O4/c1-5-24(32)28-20-13-9-18(10-14-20)7-6-8-25(33)29-21-15-11-19(12-16-21)22-17-23(22)30-31-26(34)35-27(2,3)4/h9-16,22-23,30H,5-8,17H2,1-4H3,(H,28,32)(H,29,33)(H,31,34) |
| InChIKey | QKOBUSHAWFJDID-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.61 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|