C22H32N2O5 — CID 67457237
8-[4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropyl]anilino]-8-oxooctanoic acid (PubChem CID 67457237) has the molecular formula C22H32N2O5 and a molecular weight of 404.51 g/mol. Its IUPAC name is 8-[4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropyl]anilino]-8-oxooctanoic acid.
| Compound Name | 8-[4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropyl]anilino]-8-oxooctanoic acid |
|---|---|
| PubChem CID | 67457237 |
| Molecular Formula | C22H32N2O5 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.23 |
| IUPAC Name | 8-[4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropyl]anilino]-8-oxooctanoic acid |
| SMILES | CC(C)(C)OC(=O)NC1CC1c1ccc(NC(=O)CCCCCCC(=O)O)cc1 |
| InChI | InChI=1S/C22H32N2O5/c1-22(2,3)29-21(28)24-18-14-17(18)15-10-12-16(13-11-15)23-19(25)8-6-4-5-7-9-20(26)27/h10-13,17-18H,4-9,14H2,1-3H3,(H,23,25)(H,24,28)(H,26,27) |
| InChIKey | JPFIXEXTBPCJJL-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|