C37H54N4O8 — CID 118355522
methyl 8-[4-[4-[4-[2-[(2-methylpropan-2-yl)oxycarbonyl-[(2-methylpropan-2-yl)oxycarbonylamino]amino]ethyl]anilino]-4-oxobutyl]anilino]-8-oxooctanoate (PubChem CID 118355522) has the molecular formula C37H54N4O8 and a molecular weight of 682.86 g/mol. Its IUPAC name is methyl 8-[4-[4-[4-[2-[(2-methylpropan-2-yl)oxycarbonyl-[(2-methylpropan-2-yl)oxycarbonylamino]amino]ethyl]anilino]-4-oxobutyl]anilino]-8-oxooctanoate.
| Compound Name | methyl 8-[4-[4-[4-[2-[(2-methylpropan-2-yl)oxycarbonyl-[(2-methylpropan-2-yl)oxycarbonylamino]amino]ethyl]anilino]-4-oxobutyl]anilino]-8-oxooctanoate |
|---|---|
| PubChem CID | 118355522 |
| Molecular Formula | C37H54N4O8 |
| Molecular Weight | 682.86 g/mol |
| Exact Mass | 682.39 |
| IUPAC Name | methyl 8-[4-[4-[4-[2-[(2-methylpropan-2-yl)oxycarbonyl-[(2-methylpropan-2-yl)oxycarbonylamino]amino]ethyl]anilino]-4-oxobutyl]anilino]-8-oxooctanoate |
| SMILES | COC(=O)CCCCCCC(=O)Nc1ccc(CCCC(=O)Nc2ccc(CCN(NC(=O)OC(C)(C)C)C(=O)OC(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C37H54N4O8/c1-36(2,3)48-34(45)40-41(35(46)49-37(4,5)6)26-25-28-19-23-30(24-20-28)39-32(43)15-12-13-27-17-21-29(22-18-27)38-31(42)14-10-8-9-11-16-33(44)47-7/h17-24H,8-16,25-26H2,1-7H3,(H,38,42)(H,39,43)(H,40,45) |
| InChIKey | XJUITAIBPSOXPW-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 152.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.86 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|